C15H9NO6 — CID 137100206
2-(3,4-dihydroxyphenyl)-3-hydroxy-7-nitrosochromen-4-one (PubChem CID 137100206) has the molecular formula C15H9NO6 and a molecular weight of 299.24 g/mol. Its IUPAC name is 2-(3,4-dihydroxyphenyl)-3-hydroxy-7-nitrosochromen-4-one.
| Compound Name | 2-(3,4-dihydroxyphenyl)-3-hydroxy-7-nitrosochromen-4-one |
|---|---|
| PubChem CID | 137100206 |
| Molecular Formula | C15H9NO6 |
| Molecular Weight | 299.24 g/mol |
| Exact Mass | 299.04 |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-3-hydroxy-7-nitrosochromen-4-one |
| SMILES | O=Nc1ccc2c(=O)c(O)c(-c3ccc(O)c(O)c3)oc2c1 |
| InChI | InChI=1S/C15H9NO6/c17-10-4-1-7(5-11(10)18)15-14(20)13(19)9-3-2-8(16-21)6-12(9)22-15/h1-6,17-18,20H |
| InChIKey | ZOBDVLOLTDUAHZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 120.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.24 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|