C19H17NO5 — CID 11089072
5,7-dimethoxy-N-(4-methylphenyl)-2-oxochromene-3-carboxamide (PubChem CID 11089072) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 5,7-dimethoxy-N-(4-methylphenyl)-2-oxochromene-3-carboxamide.
| Compound Name | 5,7-dimethoxy-N-(4-methylphenyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 11089072 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 5,7-dimethoxy-N-(4-methylphenyl)-2-oxochromene-3-carboxamide |
| SMILES | COc1cc(OC)c2cc(C(=O)Nc3ccc(C)cc3)c(=O)oc2c1 |
| InChI | InChI=1S/C19H17NO5/c1-11-4-6-12(7-5-11)20-18(21)15-10-14-16(24-3)8-13(23-2)9-17(14)25-19(15)22/h4-10H,1-3H3,(H,20,21) |
| InChIKey | LVJZTFWNRWJWOB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|