C24H26O7 — CID 142605306
ethane;methyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate (PubChem CID 142605306) has the molecular formula C24H26O7 and a molecular weight of 426.47 g/mol. Its IUPAC name is ethane;methyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate.
| Compound Name | ethane;methyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 142605306 |
| Molecular Formula | C24H26O7 |
| Molecular Weight | 426.47 g/mol |
| Exact Mass | 426.17 |
| IUPAC Name | ethane;methyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate |
| SMILES | CC.COC(=O)CCc1ccc(C(=O)c2cc3c(OC)cc(OC)cc3oc2=O)cc1 |
| InChI | InChI=1S/C22H20O7.C2H6/c1-26-15-10-18(27-2)16-12-17(22(25)29-19(16)11-15)21(24)14-7-4-13(5-8-14)6-9-20(23)28-3;1-2/h4-5,7-8,10-12H,6,9H2,1-3H3;1-2H3 |
| InChIKey | VZMHYMXHNPRMFU-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|