C26H24O9 — CID 158636953
1-prop-2-enoyloxyethyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate (PubChem CID 158636953) has the molecular formula C26H24O9 and a molecular weight of 480.47 g/mol. Its IUPAC name is 1-prop-2-enoyloxyethyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate.
| Compound Name | 1-prop-2-enoyloxyethyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate |
|---|---|
| PubChem CID | 158636953 |
| Molecular Formula | C26H24O9 |
| Molecular Weight | 480.47 g/mol |
| Exact Mass | 480.14 |
| IUPAC Name | 1-prop-2-enoyloxyethyl 3-[4-(5,7-dimethoxy-2-oxochromene-3-carbonyl)phenyl]propanoate |
| SMILES | C=CC(=O)OC(C)OC(=O)CCc1ccc(C(=O)c2cc3c(OC)cc(OC)cc3oc2=O)cc1 |
| InChI | InChI=1S/C26H24O9/c1-5-23(27)33-15(2)34-24(28)11-8-16-6-9-17(10-7-16)25(29)20-14-19-21(32-4)12-18(31-3)13-22(19)35-26(20)30/h5-7,9-10,12-15H,1,8,11H2,2-4H3 |
| InChIKey | OICBRZLWWFVJDA-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 118.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.47 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|