C23H21NO5 — CID 140842264
3-(4-isocyanobenzoyl)-5,7-di(propan-2-yloxy)chromen-2-one (PubChem CID 140842264) has the molecular formula C23H21NO5 and a molecular weight of 391.42 g/mol. Its IUPAC name is 3-(4-isocyanobenzoyl)-5,7-di(propan-2-yloxy)chromen-2-one.
| Compound Name | 3-(4-isocyanobenzoyl)-5,7-di(propan-2-yloxy)chromen-2-one |
|---|---|
| PubChem CID | 140842264 |
| Molecular Formula | C23H21NO5 |
| Molecular Weight | 391.42 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | 3-(4-isocyanobenzoyl)-5,7-di(propan-2-yloxy)chromen-2-one |
| SMILES | [C-]#[N+]c1ccc(C(=O)c2cc3c(OC(C)C)cc(OC(C)C)cc3oc2=O)cc1 |
| InChI | InChI=1S/C23H21NO5/c1-13(2)27-17-10-20(28-14(3)4)18-12-19(23(26)29-21(18)11-17)22(25)15-6-8-16(24-5)9-7-15/h6-14H,1-4H3 |
| InChIKey | OBVZXQMVQBKNGO-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 70.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.42 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|