C15H18O5 — CID 172769354
4,6-di(propan-2-yloxy)-1-benzofuran-2-carboxylic acid (PubChem CID 172769354) has the molecular formula C15H18O5 and a molecular weight of 278.30 g/mol. Its IUPAC name is 4,6-di(propan-2-yloxy)-1-benzofuran-2-carboxylic acid.
| Compound Name | 4,6-di(propan-2-yloxy)-1-benzofuran-2-carboxylic acid |
|---|---|
| PubChem CID | 172769354 |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 4,6-di(propan-2-yloxy)-1-benzofuran-2-carboxylic acid |
| SMILES | CC(C)Oc1cc(OC(C)C)c2cc(C(=O)O)oc2c1 |
| InChI | InChI=1S/C15H18O5/c1-8(2)18-10-5-12(19-9(3)4)11-7-14(15(16)17)20-13(11)6-10/h5-9H,1-4H3,(H,16,17) |
| InChIKey | MSZBBRZBGLUXDH-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |