C11H13NO2 — CID 170292106
4-ethyl-5-methoxy-7-methyl-1,2-benzoxazole (PubChem CID 170292106) has the molecular formula C11H13NO2 and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-ethyl-5-methoxy-7-methyl-1,2-benzoxazole.
| Compound Name | 4-ethyl-5-methoxy-7-methyl-1,2-benzoxazole |
|---|---|
| PubChem CID | 170292106 |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.09 |
| IUPAC Name | 4-ethyl-5-methoxy-7-methyl-1,2-benzoxazole |
| SMILES | CCc1c(OC)cc(C)c2oncc12 |
| InChI | InChI=1S/C11H13NO2/c1-4-8-9-6-12-14-11(9)7(2)5-10(8)13-3/h5-6H,4H2,1-3H3 |
| InChIKey | HEXOMJTUSAVDIX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 35.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |