C7H10N2O2 — CID 70465216
2,3-diamino-4-methoxyphenol (PubChem CID 70465216) has the molecular formula C7H10N2O2 and a molecular weight of 154.17 g/mol. Its IUPAC name is 2,3-diamino-4-methoxyphenol.
| Compound Name | 2,3-diamino-4-methoxyphenol |
|---|---|
| PubChem CID | 70465216 |
| Molecular Formula | C7H10N2O2 |
| Molecular Weight | 154.17 g/mol |
| Exact Mass | 154.07 |
| IUPAC Name | 2,3-diamino-4-methoxyphenol |
| SMILES | COc1ccc(O)c(N)c1N |
| InChI | InChI=1S/C7H10N2O2/c1-11-5-3-2-4(10)6(8)7(5)9/h2-3,10H,8-9H2,1H3 |
| InChIKey | BNIBHSRAFZSJJG-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.17 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|