C12H14N2O2 — CID 105423275
1-[4-(2-methoxyphenyl)-1,2-oxazol-5-yl]ethanamine (PubChem CID 105423275) has the molecular formula C12H14N2O2 and a molecular weight of 218.26 g/mol. Its IUPAC name is 1-[4-(2-methoxyphenyl)-1,2-oxazol-5-yl]ethanamine.
| Compound Name | 1-[4-(2-methoxyphenyl)-1,2-oxazol-5-yl]ethanamine |
|---|---|
| PubChem CID | 105423275 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | 1-[4-(2-methoxyphenyl)-1,2-oxazol-5-yl]ethanamine |
| SMILES | COc1ccccc1-c1cnoc1C(C)N |
| InChI | InChI=1S/C12H14N2O2/c1-8(13)12-10(7-14-16-12)9-5-3-4-6-11(9)15-2/h3-8H,13H2,1-2H3 |
| InChIKey | UVKGLVDXGUFNLW-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |