C8H10N2OS — CID 142354021
1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl thiocyanate (PubChem CID 142354021) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl thiocyanate.
| Compound Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl thiocyanate |
|---|---|
| PubChem CID | 142354021 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)ethyl thiocyanate |
| SMILES | Cc1noc(C)c1C(C)SC#N |
| InChI | InChI=1S/C8H10N2OS/c1-5-8(6(2)11-10-5)7(3)12-4-9/h7H,1-3H3 |
| InChIKey | FUTOZUILWKODFF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|