About 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol
1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol (PubChem CID 71246816) has the molecular formula C17H29NO2Si
and a molecular weight of 307.51 g/mol. Its IUPAC name is 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol.
Molecular Properties
| Compound Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol |
| PubChem CID | 71246816 |
| Molecular Formula | C17H29NO2Si |
| Molecular Weight | 307.51 g/mol |
| Exact Mass | 307.20 |
| IUPAC Name | 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol |
| SMILES | Cc1noc(C)c1C(O)C#C[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C17H29NO2Si/c1-11(2)21(12(3)4,13(5)6)10-9-16(19)17-14(7)18-20-15(17)8/h11-13,16,19H,1-8H3 |
| InChIKey | YKEOXUMPUWOWMR-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 46.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol?
The IUPAC name of 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol (CID 71246816) is 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol.
What is the SMILES notation for 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol?
The canonical SMILES for 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol is Cc1noc(C)c1C(O)C#C[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol?
The InChIKey is YKEOXUMPUWOWMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29NO2Si/c1-11(2)21(12(3)4,13(5)6)10-9-16(19)17-14(7)18-20-15(17)8/h11-13,16,19H,1-8H3.
What are the key properties of 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol?
1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol has a molecular weight of 307.51 g/mol, XLogP of 4.55, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,5-dimethyl-1,2-oxazol-4-yl)-3-tri(propan-2-yl)silylprop-2-yn-1-ol is sourced from PubChem (CID 71246816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).