C15H25N3O — CID 106709428
6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,2-dimethylhexanenitrile (PubChem CID 106709428) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709428 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]-2,2-dimethylhexanenitrile |
| SMILES | Cc1noc(C)c1C(C)NCCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H25N3O/c1-11(14-12(2)18-19-13(14)3)17-9-7-6-8-15(4,5)10-16/h11,17H,6-9H2,1-5H3 |
| InChIKey | RTTXHDULQQZKRT-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|