C13H24N2O2 — CID 113428834
6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol (PubChem CID 113428834) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol.
| Compound Name | 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol |
|---|---|
| PubChem CID | 113428834 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol |
| SMILES | Cc1noc(C)c1C(C)NCCCCCCO |
| InChI | InChI=1S/C13H24N2O2/c1-10(13-11(2)15-17-12(13)3)14-8-6-4-5-7-9-16/h10,14,16H,4-9H2,1-3H3 |
| InChIKey | MGBCWAVBWLZGHW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|