About 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol
6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol (PubChem CID 113428834) has the molecular formula C13H24N2O2
and a molecular weight of 240.35 g/mol. Its IUPAC name is 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol.
Molecular Properties
| Compound Name | 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol |
| PubChem CID | 113428834 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol |
| SMILES | Cc1noc(C)c1C(C)NCCCCCCO |
| InChI | InChI=1S/C13H24N2O2/c1-10(13-11(2)15-17-12(13)3)14-8-6-4-5-7-9-16/h10,14,16H,4-9H2,1-3H3 |
| InChIKey | MGBCWAVBWLZGHW-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol?
The IUPAC name of 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol (CID 113428834) is 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol.
What is the SMILES notation for 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol?
The canonical SMILES for 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol is Cc1noc(C)c1C(C)NCCCCCCO.
What is the InChIKey of 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol?
The InChIKey is MGBCWAVBWLZGHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H24N2O2/c1-10(13-11(2)15-17-12(13)3)14-8-6-4-5-7-9-16/h10,14,16H,4-9H2,1-3H3.
What are the key properties of 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol?
6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol has a molecular weight of 240.35 g/mol, XLogP of 2.49, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(3,5-dimethyl-1,2-oxazol-4-yl)ethylamino]hexan-1-ol is sourced from PubChem (CID 113428834), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).