C13H26N2O — CID 106709557
6-(4-hydroxypentan-2-ylamino)-2,2-dimethylhexanenitrile (PubChem CID 106709557) has the molecular formula C13H26N2O and a molecular weight of 226.36 g/mol. Its IUPAC name is 6-(4-hydroxypentan-2-ylamino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(4-hydroxypentan-2-ylamino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709557 |
| Molecular Formula | C13H26N2O |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.20 |
| IUPAC Name | 6-(4-hydroxypentan-2-ylamino)-2,2-dimethylhexanenitrile |
| SMILES | CC(O)CC(C)NCCCCC(C)(C)C#N |
| InChI | InChI=1S/C13H26N2O/c1-11(9-12(2)16)15-8-6-5-7-13(3,4)10-14/h11-12,15-16H,5-9H2,1-4H3 |
| InChIKey | QOAQUDNJVAQKBC-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 56.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|