C15H30N2 — CID 106709382
6-(3-ethylpentan-3-ylamino)-2,2-dimethylhexanenitrile (PubChem CID 106709382) has the molecular formula C15H30N2 and a molecular weight of 238.42 g/mol. Its IUPAC name is 6-(3-ethylpentan-3-ylamino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(3-ethylpentan-3-ylamino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709382 |
| Molecular Formula | C15H30N2 |
| Molecular Weight | 238.42 g/mol |
| Exact Mass | 238.24 |
| IUPAC Name | 6-(3-ethylpentan-3-ylamino)-2,2-dimethylhexanenitrile |
| SMILES | CCC(CC)(CC)NCCCCC(C)(C)C#N |
| InChI | InChI=1S/C15H30N2/c1-6-15(7-2,8-3)17-12-10-9-11-14(4,5)13-16/h17H,6-12H2,1-5H3 |
| InChIKey | PYQHRTAJUACZQX-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|