C14H28N2 — CID 106709688
6-(2,2-dimethylbutylamino)-2,2-dimethylhexanenitrile (PubChem CID 106709688) has the molecular formula C14H28N2 and a molecular weight of 224.39 g/mol. Its IUPAC name is 6-(2,2-dimethylbutylamino)-2,2-dimethylhexanenitrile.
| Compound Name | 6-(2,2-dimethylbutylamino)-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709688 |
| Molecular Formula | C14H28N2 |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.23 |
| IUPAC Name | 6-(2,2-dimethylbutylamino)-2,2-dimethylhexanenitrile |
| SMILES | CCC(C)(C)CNCCCCC(C)(C)C#N |
| InChI | InChI=1S/C14H28N2/c1-6-13(2,3)12-16-10-8-7-9-14(4,5)11-15/h16H,6-10,12H2,1-5H3 |
| InChIKey | VGYWHXYBFNJCDA-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|