C16H23FN2 — CID 106709481
6-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2,2-dimethylhexanenitrile (PubChem CID 106709481) has the molecular formula C16H23FN2 and a molecular weight of 262.37 g/mol. Its IUPAC name is 6-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2,2-dimethylhexanenitrile.
| Compound Name | 6-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2,2-dimethylhexanenitrile |
|---|---|
| PubChem CID | 106709481 |
| Molecular Formula | C16H23FN2 |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | 6-[[(1S)-1-(3-fluorophenyl)ethyl]amino]-2,2-dimethylhexanenitrile |
| SMILES | C[C@H](NCCCCC(C)(C)C#N)c1cccc(F)c1 |
| InChI | InChI=1S/C16H23FN2/c1-13(14-7-6-8-15(17)11-14)19-10-5-4-9-16(2,3)12-18/h6-8,11,13,19H,4-5,9-10H2,1-3H3/t13-/m0/s1 |
| InChIKey | BPNJLOZFDZPTMX-ZDUSSCGKSA-N |
| XLogP | 4.20 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|