C15H21FN2 — CID 65253932
5-[1-(3-fluorophenyl)ethylamino]-2,2-dimethylpentanenitrile (PubChem CID 65253932) has the molecular formula C15H21FN2 and a molecular weight of 248.34 g/mol. Its IUPAC name is 5-[1-(3-fluorophenyl)ethylamino]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[1-(3-fluorophenyl)ethylamino]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 65253932 |
| Molecular Formula | C15H21FN2 |
| Molecular Weight | 248.34 g/mol |
| Exact Mass | 248.17 |
| IUPAC Name | 5-[1-(3-fluorophenyl)ethylamino]-2,2-dimethylpentanenitrile |
| SMILES | CC(NCCCC(C)(C)C#N)c1cccc(F)c1 |
| InChI | InChI=1S/C15H21FN2/c1-12(13-6-4-7-14(16)10-13)18-9-5-8-15(2,3)11-17/h4,6-7,10,12,18H,5,8-9H2,1-3H3 |
| InChIKey | YUVPVJDRVRUFNQ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.34 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|