C15H23N3 — CID 106709505
2,2-dimethyl-6-[[(1R)-1-pyridin-3-ylethyl]amino]hexanenitrile (PubChem CID 106709505) has the molecular formula C15H23N3 and a molecular weight of 245.37 g/mol. Its IUPAC name is 2,2-dimethyl-6-[[(1R)-1-pyridin-3-ylethyl]amino]hexanenitrile.
| Compound Name | 2,2-dimethyl-6-[[(1R)-1-pyridin-3-ylethyl]amino]hexanenitrile |
|---|---|
| PubChem CID | 106709505 |
| Molecular Formula | C15H23N3 |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.19 |
| IUPAC Name | 2,2-dimethyl-6-[[(1R)-1-pyridin-3-ylethyl]amino]hexanenitrile |
| SMILES | C[C@@H](NCCCCC(C)(C)C#N)c1cccnc1 |
| InChI | InChI=1S/C15H23N3/c1-13(14-7-6-9-17-11-14)18-10-5-4-8-15(2,3)12-16/h6-7,9,11,13,18H,4-5,8,10H2,1-3H3/t13-/m1/s1 |
| InChIKey | XGMICNMNVGFISK-CYBMUJFWSA-N |
| XLogP | 3.45 |
| TPSA | 48.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|