C15H21ClN2 — CID 81353286
5-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2,2-dimethylpentanenitrile (PubChem CID 81353286) has the molecular formula C15H21ClN2 and a molecular weight of 264.80 g/mol. Its IUPAC name is 5-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2,2-dimethylpentanenitrile.
| Compound Name | 5-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2,2-dimethylpentanenitrile |
|---|---|
| PubChem CID | 81353286 |
| Molecular Formula | C15H21ClN2 |
| Molecular Weight | 264.80 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 5-[[(1R)-1-(4-chlorophenyl)ethyl]amino]-2,2-dimethylpentanenitrile |
| SMILES | C[C@@H](NCCCC(C)(C)C#N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H21ClN2/c1-12(13-5-7-14(16)8-6-13)18-10-4-9-15(2,3)11-17/h5-8,12,18H,4,9-10H2,1-3H3/t12-/m1/s1 |
| InChIKey | WUPAIZLUQWDSKY-GFCCVEGCSA-N |
| XLogP | 4.32 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.80 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|