C11H17ClN2 — CID 60889323
N'-[1-(4-chlorophenyl)ethyl]propane-1,3-diamine (PubChem CID 60889323) has the molecular formula C11H17ClN2 and a molecular weight of 212.72 g/mol. Its IUPAC name is N'-[1-(4-chlorophenyl)ethyl]propane-1,3-diamine.
| Compound Name | N'-[1-(4-chlorophenyl)ethyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60889323 |
| Molecular Formula | C11H17ClN2 |
| Molecular Weight | 212.72 g/mol |
| Exact Mass | 212.11 |
| IUPAC Name | N'-[1-(4-chlorophenyl)ethyl]propane-1,3-diamine |
| SMILES | CC(NCCCN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C11H17ClN2/c1-9(14-8-2-7-13)10-3-5-11(12)6-4-10/h3-6,9,14H,2,7-8,13H2,1H3 |
| InChIKey | JWZDYPDBWXQYIR-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.72 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|