C15H16BrN — CID 169336629
10-bromo-1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carbonitrile (PubChem CID 169336629) has the molecular formula C15H16BrN and a molecular weight of 290.20 g/mol. Its IUPAC name is 10-bromo-1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carbonitrile.
| Compound Name | 10-bromo-1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carbonitrile |
|---|---|
| PubChem CID | 169336629 |
| Molecular Formula | C15H16BrN |
| Molecular Weight | 290.20 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 10-bromo-1,2,3,4,5,6,7,8-octahydrophenanthrene-9-carbonitrile |
| SMILES | N#Cc1c(Br)c2c(c3c1CCCC3)CCCC2 |
| InChI | InChI=1S/C15H16BrN/c16-15-13-8-4-3-6-11(13)10-5-1-2-7-12(10)14(15)9-17/h1-8H2 |
| InChIKey | LBGHTQNHCHNJKG-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.20 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |