About 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile
4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile (PubChem CID 6424413) has the molecular formula C10H8N2S
and a molecular weight of 188.25 g/mol. Its IUPAC name is 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile.
Analyze 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile?
The IUPAC name of 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile (CID 6424413) is 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile.
What is the SMILES notation for 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile?
The canonical SMILES for 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile is N#Cc1sc2c(c1C#N)CCCC2.
What is the InChIKey of 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile?
The InChIKey is XIQTYGCYGMSBSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8N2S/c11-5-8-7-3-1-2-4-9(7)13-10(8)6-12/h1-4H2.
What are the key properties of 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile?
4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile has a molecular weight of 188.25 g/mol, XLogP of 2.37, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6,7-tetrahydro-1-benzothiophene-2,3-dicarbonitrile is sourced from PubChem (CID 6424413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).