C11H12N2S3 — CID 14903806
methyl N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamodithioate (PubChem CID 14903806) has the molecular formula C11H12N2S3 and a molecular weight of 268.43 g/mol. Its IUPAC name is methyl N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamodithioate.
| Compound Name | methyl N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamodithioate |
|---|---|
| PubChem CID | 14903806 |
| Molecular Formula | C11H12N2S3 |
| Molecular Weight | 268.43 g/mol |
| Exact Mass | 268.02 |
| IUPAC Name | methyl N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)carbamodithioate |
| SMILES | CSC(=S)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C11H12N2S3/c1-15-11(14)13-10-8(6-12)7-4-2-3-5-9(7)16-10/h2-5H2,1H3,(H,13,14) |
| InChIKey | TUVSFWHUXDMQHO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|