C15H15N3O2S2 — CID 10246244
methyl (E)-2-cyano-3-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-methylsulfanylprop-2-enoate (PubChem CID 10246244) has the molecular formula C15H15N3O2S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is methyl (E)-2-cyano-3-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-methylsulfanylprop-2-enoate.
| Compound Name | methyl (E)-2-cyano-3-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-methylsulfanylprop-2-enoate |
|---|---|
| PubChem CID | 10246244 |
| Molecular Formula | C15H15N3O2S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | methyl (E)-2-cyano-3-[(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)amino]-3-methylsulfanylprop-2-enoate |
| SMILES | COC(=O)/C(C#N)=C(\Nc1sc2c(c1C#N)CCCC2)SC |
| InChI | InChI=1S/C15H15N3O2S2/c1-20-15(19)11(8-17)13(21-2)18-14-10(7-16)9-5-3-4-6-12(9)22-14/h18H,3-6H2,1-2H3/b13-11+ |
| InChIKey | DGPVMYJUZCNDAD-ACCUITESSA-N |
| XLogP | 3.18 |
| TPSA | 85.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|