C14H17N3OS3 — CID 10359851
2-[bis(methylsulfanyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide (PubChem CID 10359851) has the molecular formula C14H17N3OS3 and a molecular weight of 339.51 g/mol. Its IUPAC name is 2-[bis(methylsulfanyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide.
| Compound Name | 2-[bis(methylsulfanyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 10359851 |
| Molecular Formula | C14H17N3OS3 |
| Molecular Weight | 339.51 g/mol |
| Exact Mass | 339.05 |
| IUPAC Name | 2-[bis(methylsulfanyl)methylideneamino]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)acetamide |
| SMILES | CSC(=NCC(=O)Nc1sc2c(c1C#N)CCCC2)SC |
| InChI | InChI=1S/C14H17N3OS3/c1-19-14(20-2)16-8-12(18)17-13-10(7-15)9-5-3-4-6-11(9)21-13/h3-6,8H2,1-2H3,(H,17,18) |
| InChIKey | QVGLENPDPUYNFO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 65.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.51 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|