C16H17N5O2S — CID 71769021
(3E)-3-[(2-cyanoacetyl)hydrazinylidene]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide (PubChem CID 71769021) has the molecular formula C16H17N5O2S and a molecular weight of 343.41 g/mol. Its IUPAC name is (3E)-3-[(2-cyanoacetyl)hydrazinylidene]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide.
| Compound Name | (3E)-3-[(2-cyanoacetyl)hydrazinylidene]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide |
|---|---|
| PubChem CID | 71769021 |
| Molecular Formula | C16H17N5O2S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (3E)-3-[(2-cyanoacetyl)hydrazinylidene]-N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)butanamide |
| SMILES | C/C(CC(=O)Nc1sc2c(c1C#N)CCCC2)=N\NC(=O)CC#N |
| InChI | InChI=1S/C16H17N5O2S/c1-10(20-21-14(22)6-7-17)8-15(23)19-16-12(9-18)11-4-2-3-5-13(11)24-16/h2-6,8H2,1H3,(H,19,23)(H,21,22)/b20-10+ |
| InChIKey | GFNIOGDQHCZSGI-KEBDBYFISA-N |
| XLogP | 2.23 |
| TPSA | 118.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|