C15H20N2OS — CID 4134135
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hexanamide (PubChem CID 4134135) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hexanamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hexanamide |
|---|---|
| PubChem CID | 4134135 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)hexanamide |
| SMILES | CCCCCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C15H20N2OS/c1-2-3-4-9-14(18)17-15-12(10-16)11-7-5-6-8-13(11)19-15/h2-9H2,1H3,(H,17,18) |
| InChIKey | WAWOATMBLULURZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|