C19H26N2OS — CID 3112655
N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dec-9-enamide (PubChem CID 3112655) has the molecular formula C19H26N2OS and a molecular weight of 330.50 g/mol. Its IUPAC name is N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dec-9-enamide.
| Compound Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dec-9-enamide |
|---|---|
| PubChem CID | 3112655 |
| Molecular Formula | C19H26N2OS |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.18 |
| IUPAC Name | N-(3-cyano-4,5,6,7-tetrahydro-1-benzothiophen-2-yl)dec-9-enamide |
| SMILES | C=CCCCCCCCC(=O)Nc1sc2c(c1C#N)CCCC2 |
| InChI | InChI=1S/C19H26N2OS/c1-2-3-4-5-6-7-8-13-18(22)21-19-16(14-20)15-11-9-10-12-17(15)23-19/h2H,1,3-13H2,(H,21,22) |
| InChIKey | AQWXYCOZTBNAGB-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|