C17H26N2O2S — CID 68743533
2-(hexanoylamino)-N,N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide (PubChem CID 68743533) has the molecular formula C17H26N2O2S and a molecular weight of 322.47 g/mol. Its IUPAC name is 2-(hexanoylamino)-N,N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide.
| Compound Name | 2-(hexanoylamino)-N,N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 68743533 |
| Molecular Formula | C17H26N2O2S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 2-(hexanoylamino)-N,N-dimethyl-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxamide |
| SMILES | CCCCCC(=O)Nc1sc2c(c1C(=O)N(C)C)CCCC2 |
| InChI | InChI=1S/C17H26N2O2S/c1-4-5-6-11-14(20)18-16-15(17(21)19(2)3)12-9-7-8-10-13(12)22-16/h4-11H2,1-3H3,(H,18,20) |
| InChIKey | YNFRQSKPYBLTMH-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|