C7H4Br2N2Se — CID 172831247
4,7-dibromo-5-methyl-2,1,3-benzoselenadiazole (PubChem CID 172831247) has the molecular formula C7H4Br2N2Se and a molecular weight of 354.89 g/mol. Its IUPAC name is 4,7-dibromo-5-methyl-2,1,3-benzoselenadiazole.
| Compound Name | 4,7-dibromo-5-methyl-2,1,3-benzoselenadiazole |
|---|---|
| PubChem CID | 172831247 |
| Molecular Formula | C7H4Br2N2Se |
| Molecular Weight | 354.89 g/mol |
| Exact Mass | 353.79 |
| IUPAC Name | 4,7-dibromo-5-methyl-2,1,3-benzoselenadiazole |
| SMILES | Cc1cc(Br)c2n[se]nc2c1Br |
| InChI | InChI=1S/C7H4Br2N2Se/c1-3-2-4(8)6-7(5(3)9)11-12-10-6/h2H,1H3 |
| InChIKey | VNSFRMABJWVMJI-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.89 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|