C10H15BrFN — CID 168927832
3-bromo-4-fluoro-2,6-dimethylaniline;ethane (PubChem CID 168927832) has the molecular formula C10H15BrFN and a molecular weight of 248.14 g/mol. Its IUPAC name is 3-bromo-4-fluoro-2,6-dimethylaniline;ethane.
| Compound Name | 3-bromo-4-fluoro-2,6-dimethylaniline;ethane |
|---|---|
| PubChem CID | 168927832 |
| Molecular Formula | C10H15BrFN |
| Molecular Weight | 248.14 g/mol |
| Exact Mass | 247.04 |
| IUPAC Name | 3-bromo-4-fluoro-2,6-dimethylaniline;ethane |
| SMILES | CC.Cc1cc(F)c(Br)c(C)c1N |
| InChI | InChI=1S/C8H9BrFN.C2H6/c1-4-3-6(10)7(9)5(2)8(4)11;1-2/h3H,11H2,1-2H3;1-2H3 |
| InChIKey | IAJGDTYYOUAIEW-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.14 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|