C15H12Br3F — CID 107958952
5-[bromo-(2,4-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene (PubChem CID 107958952) has the molecular formula C15H12Br3F and a molecular weight of 450.97 g/mol. Its IUPAC name is 5-[bromo-(2,4-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene.
| Compound Name | 5-[bromo-(2,4-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene |
|---|---|
| PubChem CID | 107958952 |
| Molecular Formula | C15H12Br3F |
| Molecular Weight | 450.97 g/mol |
| Exact Mass | 447.85 |
| IUPAC Name | 5-[bromo-(2,4-dibromophenyl)methyl]-2-fluoro-1,3-dimethylbenzene |
| SMILES | Cc1cc(C(Br)c2ccc(Br)cc2Br)cc(C)c1F |
| InChI | InChI=1S/C15H12Br3F/c1-8-5-10(6-9(2)15(8)19)14(18)12-4-3-11(16)7-13(12)17/h3-7,14H,1-2H3 |
| InChIKey | QPZMCNPDZIKZRB-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.97 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|