C13H8Br4 — CID 107957822
2,4-dibromo-1-[bromo-(4-bromophenyl)methyl]benzene (PubChem CID 107957822) has the molecular formula C13H8Br4 and a molecular weight of 483.82 g/mol. Its IUPAC name is 2,4-dibromo-1-[bromo-(4-bromophenyl)methyl]benzene.
| Compound Name | 2,4-dibromo-1-[bromo-(4-bromophenyl)methyl]benzene |
|---|---|
| PubChem CID | 107957822 |
| Molecular Formula | C13H8Br4 |
| Molecular Weight | 483.82 g/mol |
| Exact Mass | 479.74 |
| IUPAC Name | 2,4-dibromo-1-[bromo-(4-bromophenyl)methyl]benzene |
| SMILES | Brc1ccc(C(Br)c2ccc(Br)cc2Br)cc1 |
| InChI | InChI=1S/C13H8Br4/c14-9-3-1-8(2-4-9)13(17)11-6-5-10(15)7-12(11)16/h1-7,13H |
| InChIKey | CSDVKJXQUVOPIH-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.82 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|