C8H9Br2N — CID 73012416
2-(2,4-dibromophenyl)ethanamine (PubChem CID 73012416) has the molecular formula C8H9Br2N and a molecular weight of 278.97 g/mol. Its IUPAC name is 2-(2,4-dibromophenyl)ethanamine.
| Compound Name | 2-(2,4-dibromophenyl)ethanamine |
|---|---|
| PubChem CID | 73012416 |
| Molecular Formula | C8H9Br2N |
| Molecular Weight | 278.97 g/mol |
| Exact Mass | 276.91 |
| IUPAC Name | 2-(2,4-dibromophenyl)ethanamine |
| SMILES | NCCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C8H9Br2N/c9-7-2-1-6(3-4-11)8(10)5-7/h1-2,5H,3-4,11H2 |
| InChIKey | XNLOOXUPQJKGLB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.97 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |