About 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene
2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene (PubChem CID 87271431) has the molecular formula C16H14Br4S2
and a molecular weight of 590.04 g/mol. Its IUPAC name is 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene.
Molecular Properties
| Compound Name | 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene |
| PubChem CID | 87271431 |
| Molecular Formula | C16H14Br4S2 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 585.73 |
| IUPAC Name | 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene |
| SMILES | Brc1ccc(CCSSCCc2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C16H14Br4S2/c17-13-3-1-11(15(19)9-13)5-7-21-22-8-6-12-2-4-14(18)10-16(12)20/h1-4,9-10H,5-8H2 |
| InChIKey | POBBYNOJCPJYQY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene?
The IUPAC name of 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene (CID 87271431) is 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene.
What is the SMILES notation for 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene?
The canonical SMILES for 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene is Brc1ccc(CCSSCCc2ccc(Br)cc2Br)c(Br)c1.
What is the InChIKey of 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene?
The InChIKey is POBBYNOJCPJYQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14Br4S2/c17-13-3-1-11(15(19)9-13)5-7-21-22-8-6-12-2-4-14(18)10-16(12)20/h1-4,9-10H,5-8H2.
What are the key properties of 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene?
2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene has a molecular weight of 590.04 g/mol, XLogP of 7.90, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene is sourced from PubChem (CID 87271431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).