C16H14Br4S2 — CID 87271431
2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene (PubChem CID 87271431) has the molecular formula C16H14Br4S2 and a molecular weight of 590.04 g/mol. Its IUPAC name is 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene.
| Compound Name | 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene |
|---|---|
| PubChem CID | 87271431 |
| Molecular Formula | C16H14Br4S2 |
| Molecular Weight | 590.04 g/mol |
| Exact Mass | 585.73 |
| IUPAC Name | 2,4-dibromo-1-[2-[2-(2,4-dibromophenyl)ethyldisulfanyl]ethyl]benzene |
| SMILES | Brc1ccc(CCSSCCc2ccc(Br)cc2Br)c(Br)c1 |
| InChI | InChI=1S/C16H14Br4S2/c17-13-3-1-11(15(19)9-13)5-7-21-22-8-6-12-2-4-14(18)10-16(12)20/h1-4,9-10H,5-8H2 |
| InChIKey | POBBYNOJCPJYQY-UHFFFAOYSA-N |
| XLogP | 7.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.04 |
| LogP ≤ 5 | 7.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|