C12H10Br3N — CID 13381020
1-[(2,4-dibromophenyl)methyl]pyridin-1-ium bromide (PubChem CID 13381020) has the molecular formula C12H10Br3N and a molecular weight of 407.93 g/mol. Its IUPAC name is 1-[(2,4-dibromophenyl)methyl]pyridin-1-ium bromide.
| Compound Name | 1-[(2,4-dibromophenyl)methyl]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 13381020 |
| Molecular Formula | C12H10Br3N |
| Molecular Weight | 407.93 g/mol |
| Exact Mass | 404.84 |
| IUPAC Name | 1-[(2,4-dibromophenyl)methyl]pyridin-1-ium bromide |
| SMILES | Brc1ccc(C[n+]2ccccc2)c(Br)c1.[Br-] |
| InChI | InChI=1S/C12H10Br2N.BrH/c13-11-5-4-10(12(14)8-11)9-15-6-2-1-3-7-15;/h1-8H,9H2;1H/q+1;/p-1 |
| InChIKey | PIKOKKCRKAKFEO-UHFFFAOYSA-M |
| XLogP | 0.55 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.93 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|