C12H9Br4N — CID 13381026
1-[(2,4,5-tribromophenyl)methyl]pyridin-1-ium bromide (PubChem CID 13381026) has the molecular formula C12H9Br4N and a molecular weight of 486.83 g/mol. Its IUPAC name is 1-[(2,4,5-tribromophenyl)methyl]pyridin-1-ium bromide.
| Compound Name | 1-[(2,4,5-tribromophenyl)methyl]pyridin-1-ium bromide |
|---|---|
| PubChem CID | 13381026 |
| Molecular Formula | C12H9Br4N |
| Molecular Weight | 486.83 g/mol |
| Exact Mass | 482.75 |
| IUPAC Name | 1-[(2,4,5-tribromophenyl)methyl]pyridin-1-ium bromide |
| SMILES | Brc1cc(Br)c(C[n+]2ccccc2)cc1Br.[Br-] |
| InChI | InChI=1S/C12H9Br3N.BrH/c13-10-7-12(15)11(14)6-9(10)8-16-4-2-1-3-5-16;/h1-7H,8H2;1H/q+1;/p-1 |
| InChIKey | AYZWKNJCTDAKPT-UHFFFAOYSA-M |
| XLogP | 1.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.83 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|