C21H19BrNO2+ — CID 36583122
4-benzyl-1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-1-ium (PubChem CID 36583122) has the molecular formula C21H19BrNO2+ and a molecular weight of 397.29 g/mol. Its IUPAC name is 4-benzyl-1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-1-ium.
| Compound Name | 4-benzyl-1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 36583122 |
| Molecular Formula | C21H19BrNO2+ |
| Molecular Weight | 397.29 g/mol |
| Exact Mass | 396.06 |
| IUPAC Name | 4-benzyl-1-[(6-bromo-2,3-dihydro-1,4-benzodioxin-7-yl)methyl]pyridin-1-ium |
| SMILES | Brc1cc2c(cc1C[n+]1ccc(Cc3ccccc3)cc1)OCCO2 |
| InChI | InChI=1S/C21H19BrNO2/c22-19-14-21-20(24-10-11-25-21)13-18(19)15-23-8-6-17(7-9-23)12-16-4-2-1-3-5-16/h1-9,13-14H,10-12,15H2/q+1 |
| InChIKey | JSSLIROQNGNMEV-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 22.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|