C19H16Cl2N+ — CID 8860257
4-benzyl-1-[(2,4-dichlorophenyl)methyl]pyridin-1-ium (PubChem CID 8860257) has the molecular formula C19H16Cl2N+ and a molecular weight of 329.25 g/mol. Its IUPAC name is 4-benzyl-1-[(2,4-dichlorophenyl)methyl]pyridin-1-ium.
| Compound Name | 4-benzyl-1-[(2,4-dichlorophenyl)methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 8860257 |
| Molecular Formula | C19H16Cl2N+ |
| Molecular Weight | 329.25 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | 4-benzyl-1-[(2,4-dichlorophenyl)methyl]pyridin-1-ium |
| SMILES | Clc1ccc(C[n+]2ccc(Cc3ccccc3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C19H16Cl2N/c20-18-7-6-17(19(21)13-18)14-22-10-8-16(9-11-22)12-15-4-2-1-3-5-15/h1-11,13H,12,14H2/q+1 |
| InChIKey | KYRAYZLUWKQDQJ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.25 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|