C14H14Cl2 — CID 144850589
1-benzyl-3,5-dichlorobenzene;methane (PubChem CID 144850589) has the molecular formula C14H14Cl2 and a molecular weight of 253.17 g/mol. Its IUPAC name is 1-benzyl-3,5-dichlorobenzene;methane.
| Compound Name | 1-benzyl-3,5-dichlorobenzene;methane |
|---|---|
| PubChem CID | 144850589 |
| Molecular Formula | C14H14Cl2 |
| Molecular Weight | 253.17 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 1-benzyl-3,5-dichlorobenzene;methane |
| SMILES | C.Clc1cc(Cl)cc(Cc2ccccc2)c1 |
| InChI | InChI=1S/C13H10Cl2.CH4/c14-12-7-11(8-13(15)9-12)6-10-4-2-1-3-5-10;/h1-5,7-9H,6H2;1H4 |
| InChIKey | DRMZGFWNFUXVHW-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.17 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |