C12H9Br3N+ — CID 13381025
1-[(2,3,4-tribromophenyl)methyl]pyridin-1-ium (PubChem CID 13381025) has the molecular formula C12H9Br3N+ and a molecular weight of 406.92 g/mol. Its IUPAC name is 1-[(2,3,4-tribromophenyl)methyl]pyridin-1-ium.
| Compound Name | 1-[(2,3,4-tribromophenyl)methyl]pyridin-1-ium |
|---|---|
| PubChem CID | 13381025 |
| Molecular Formula | C12H9Br3N+ |
| Molecular Weight | 406.92 g/mol |
| Exact Mass | 403.83 |
| IUPAC Name | 1-[(2,3,4-tribromophenyl)methyl]pyridin-1-ium |
| SMILES | Brc1ccc(C[n+]2ccccc2)c(Br)c1Br |
| InChI | InChI=1S/C12H9Br3N/c13-10-5-4-9(11(14)12(10)15)8-16-6-2-1-3-7-16/h1-7H,8H2/q+1 |
| InChIKey | TXOMXXCBVUBBAE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.92 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|