C9H7Br2N — CID 130849620
3-(2,4-dibromophenyl)propanenitrile (PubChem CID 130849620) has the molecular formula C9H7Br2N and a molecular weight of 288.97 g/mol. Its IUPAC name is 3-(2,4-dibromophenyl)propanenitrile.
| Compound Name | 3-(2,4-dibromophenyl)propanenitrile |
|---|---|
| PubChem CID | 130849620 |
| Molecular Formula | C9H7Br2N |
| Molecular Weight | 288.97 g/mol |
| Exact Mass | 286.89 |
| IUPAC Name | 3-(2,4-dibromophenyl)propanenitrile |
| SMILES | N#CCCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C9H7Br2N/c10-8-4-3-7(2-1-5-12)9(11)6-8/h3-4,6H,1-2H2 |
| InChIKey | KPQOOTRLASCBFL-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.97 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |