C15H10Br4O3 — CID 164884274
bis[(2,4-dibromophenyl)methyl] carbonate (PubChem CID 164884274) has the molecular formula C15H10Br4O3 and a molecular weight of 557.86 g/mol. Its IUPAC name is bis[(2,4-dibromophenyl)methyl] carbonate.
| Compound Name | bis[(2,4-dibromophenyl)methyl] carbonate |
|---|---|
| PubChem CID | 164884274 |
| Molecular Formula | C15H10Br4O3 |
| Molecular Weight | 557.86 g/mol |
| Exact Mass | 553.74 |
| IUPAC Name | bis[(2,4-dibromophenyl)methyl] carbonate |
| SMILES | O=C(OCc1ccc(Br)cc1Br)OCc1ccc(Br)cc1Br |
| InChI | InChI=1S/C15H10Br4O3/c16-11-3-1-9(13(18)5-11)7-21-15(20)22-8-10-2-4-12(17)6-14(10)19/h1-6H,7-8H2 |
| InChIKey | GZYDVWMKPNHFSZ-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.86 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |