C14H11Br2NO2 — CID 19612076
2-amino-3-[(2,4-dibromophenyl)methyl]benzoic acid (PubChem CID 19612076) has the molecular formula C14H11Br2NO2 and a molecular weight of 385.06 g/mol. Its IUPAC name is 2-amino-3-[(2,4-dibromophenyl)methyl]benzoic acid.
| Compound Name | 2-amino-3-[(2,4-dibromophenyl)methyl]benzoic acid |
|---|---|
| PubChem CID | 19612076 |
| Molecular Formula | C14H11Br2NO2 |
| Molecular Weight | 385.06 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | 2-amino-3-[(2,4-dibromophenyl)methyl]benzoic acid |
| SMILES | Nc1c(Cc2ccc(Br)cc2Br)cccc1C(=O)O |
| InChI | InChI=1S/C14H11Br2NO2/c15-10-5-4-8(12(16)7-10)6-9-2-1-3-11(13(9)17)14(18)19/h1-5,7H,6,17H2,(H,18,19) |
| InChIKey | YUDFJABBVLJSPM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.06 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|