C16H11BrN2O4 — CID 151131845
2-amino-3-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]benzoic acid (PubChem CID 151131845) has the molecular formula C16H11BrN2O4 and a molecular weight of 375.18 g/mol. Its IUPAC name is 2-amino-3-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]benzoic acid.
| Compound Name | 2-amino-3-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]benzoic acid |
|---|---|
| PubChem CID | 151131845 |
| Molecular Formula | C16H11BrN2O4 |
| Molecular Weight | 375.18 g/mol |
| Exact Mass | 373.99 |
| IUPAC Name | 2-amino-3-[(5-bromo-1,3-dioxoisoindol-2-yl)methyl]benzoic acid |
| SMILES | Nc1c(CN2C(=O)c3ccc(Br)cc3C2=O)cccc1C(=O)O |
| InChI | InChI=1S/C16H11BrN2O4/c17-9-4-5-10-12(6-9)15(21)19(14(10)20)7-8-2-1-3-11(13(8)18)16(22)23/h1-6H,7,18H2,(H,22,23) |
| InChIKey | MUJSJXCIFRYCIB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.18 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|