About 2-(5-bromo-1H-indol-3-yl)ethanamine;methane
2-(5-bromo-1H-indol-3-yl)ethanamine;methane (PubChem CID 139467696) has the molecular formula C11H15BrN2
and a molecular weight of 255.16 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)ethanamine;methane.
Molecular Properties
| Compound Name | 2-(5-bromo-1H-indol-3-yl)ethanamine;methane |
| PubChem CID | 139467696 |
| Molecular Formula | C11H15BrN2 |
| Molecular Weight | 255.16 g/mol |
| Exact Mass | 254.04 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)ethanamine;methane |
| SMILES | C.NCCc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C10H11BrN2.CH4/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10;/h1-2,5-6,13H,3-4,12H2;1H4 |
| InChIKey | ZWOSLFBCSVKPFF-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 41.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.16 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(5-bromo-1H-indol-3-yl)ethanamine;methane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5-bromo-1H-indol-3-yl)ethanamine;methane?
The IUPAC name of 2-(5-bromo-1H-indol-3-yl)ethanamine;methane (CID 139467696) is 2-(5-bromo-1H-indol-3-yl)ethanamine;methane.
What is the SMILES notation for 2-(5-bromo-1H-indol-3-yl)ethanamine;methane?
The canonical SMILES for 2-(5-bromo-1H-indol-3-yl)ethanamine;methane is C.NCCc1c[nH]c2ccc(Br)cc12.
What is the InChIKey of 2-(5-bromo-1H-indol-3-yl)ethanamine;methane?
The InChIKey is ZWOSLFBCSVKPFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrN2.CH4/c11-8-1-2-10-9(5-8)7(3-4-12)6-13-10;/h1-2,5-6,13H,3-4,12H2;1H4.
What are the key properties of 2-(5-bromo-1H-indol-3-yl)ethanamine;methane?
2-(5-bromo-1H-indol-3-yl)ethanamine;methane has a molecular weight of 255.16 g/mol, XLogP of 3.07, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5-bromo-1H-indol-3-yl)ethanamine;methane is sourced from PubChem (CID 139467696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).