C12H15BrN2O — CID 53493869
2-(5-bromo-1H-indol-3-yl)-N,N-dimethylethanamine oxide (PubChem CID 53493869) has the molecular formula C12H15BrN2O and a molecular weight of 283.17 g/mol. Its IUPAC name is 2-(5-bromo-1H-indol-3-yl)-N,N-dimethylethanamine oxide.
| Compound Name | 2-(5-bromo-1H-indol-3-yl)-N,N-dimethylethanamine oxide |
|---|---|
| PubChem CID | 53493869 |
| Molecular Formula | C12H15BrN2O |
| Molecular Weight | 283.17 g/mol |
| Exact Mass | 282.04 |
| IUPAC Name | 2-(5-bromo-1H-indol-3-yl)-N,N-dimethylethanamine oxide |
| SMILES | C[N+](C)([O-])CCc1c[nH]c2ccc(Br)cc12 |
| InChI | InChI=1S/C12H15BrN2O/c1-15(2,16)6-5-9-8-14-12-4-3-10(13)7-11(9)12/h3-4,7-8,14H,5-6H2,1-2H3 |
| InChIKey | OVGNDEXKNOQFCA-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 38.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.17 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|