C8H9BrClF2N — CID 170912586
2-(2-bromo-4,5-difluorophenyl)ethanamine;hydrochloride (PubChem CID 170912586) has the molecular formula C8H9BrClF2N and a molecular weight of 272.52 g/mol. Its IUPAC name is 2-(2-bromo-4,5-difluorophenyl)ethanamine;hydrochloride.
| Compound Name | 2-(2-bromo-4,5-difluorophenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 170912586 |
| Molecular Formula | C8H9BrClF2N |
| Molecular Weight | 272.52 g/mol |
| Exact Mass | 270.96 |
| IUPAC Name | 2-(2-bromo-4,5-difluorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.NCCc1cc(F)c(F)cc1Br |
| InChI | InChI=1S/C8H8BrF2N.ClH/c9-6-4-8(11)7(10)3-5(6)1-2-12;/h3-4H,1-2,12H2;1H |
| InChIKey | SOAHPSUVBGZYDB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.52 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|