C9H10BrF2N — CID 84803842
3-(4-bromo-2,5-difluorophenyl)propan-1-amine (PubChem CID 84803842) has the molecular formula C9H10BrF2N and a molecular weight of 250.09 g/mol. Its IUPAC name is 3-(4-bromo-2,5-difluorophenyl)propan-1-amine.
| Compound Name | 3-(4-bromo-2,5-difluorophenyl)propan-1-amine |
|---|---|
| PubChem CID | 84803842 |
| Molecular Formula | C9H10BrF2N |
| Molecular Weight | 250.09 g/mol |
| Exact Mass | 249.00 |
| IUPAC Name | 3-(4-bromo-2,5-difluorophenyl)propan-1-amine |
| SMILES | NCCCc1cc(F)c(Br)cc1F |
| InChI | InChI=1S/C9H10BrF2N/c10-7-5-8(11)6(2-1-3-13)4-9(7)12/h4-5H,1-3,13H2 |
| InChIKey | CUIPBFJIYWDJJG-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.09 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|